C29H35O4P — CID 71191558
1-[2-[3-(3,5-dimethoxy-2-phenylmethoxyphenyl)hexan-3-ylphosphanyl]phenyl]ethanone (PubChem CID 71191558) has the molecular formula C29H35O4P and a molecular weight of 478.57 g/mol. Its IUPAC name is 1-[2-[3-(3,5-dimethoxy-2-phenylmethoxyphenyl)hexan-3-ylphosphanyl]phenyl]ethanone.
| Compound Name | 1-[2-[3-(3,5-dimethoxy-2-phenylmethoxyphenyl)hexan-3-ylphosphanyl]phenyl]ethanone |
|---|---|
| PubChem CID | 71191558 |
| Molecular Formula | C29H35O4P |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 1-[2-[3-(3,5-dimethoxy-2-phenylmethoxyphenyl)hexan-3-ylphosphanyl]phenyl]ethanone |
| SMILES | CCCC(CC)(Pc1ccccc1C(C)=O)c1cc(OC)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H35O4P/c1-6-17-29(7-2,34-27-16-12-11-15-24(27)21(3)30)25-18-23(31-4)19-26(32-5)28(25)33-20-22-13-9-8-10-14-22/h8-16,18-19,34H,6-7,17,20H2,1-5H3 |
| InChIKey | MMYKJORSEYJHPE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|