C15H17BO6 — CID 22933086
(3,5-dimethoxy-4-phenylmethoxyphenoxy)boronic acid (PubChem CID 22933086) has the molecular formula C15H17BO6 and a molecular weight of 304.11 g/mol. Its IUPAC name is (3,5-dimethoxy-4-phenylmethoxyphenoxy)boronic acid.
| Compound Name | (3,5-dimethoxy-4-phenylmethoxyphenoxy)boronic acid |
|---|---|
| PubChem CID | 22933086 |
| Molecular Formula | C15H17BO6 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | (3,5-dimethoxy-4-phenylmethoxyphenoxy)boronic acid |
| SMILES | COc1cc(OB(O)O)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C15H17BO6/c1-19-13-8-12(22-16(17)18)9-14(20-2)15(13)21-10-11-6-4-3-5-7-11/h3-9,17-18H,10H2,1-2H3 |
| InChIKey | CPCPJVGSLPNJBG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|