C32H31ClO9 — CID 159259540
3,5-dimethoxy-4-phenylmethoxybenzoic acid;3,5-dimethoxy-4-phenylmethoxybenzoyl chloride (PubChem CID 159259540) has the molecular formula C32H31ClO9 and a molecular weight of 595.04 g/mol. Its IUPAC name is 3,5-dimethoxy-4-phenylmethoxybenzoic acid;3,5-dimethoxy-4-phenylmethoxybenzoyl chloride.
| Compound Name | 3,5-dimethoxy-4-phenylmethoxybenzoic acid;3,5-dimethoxy-4-phenylmethoxybenzoyl chloride |
|---|---|
| PubChem CID | 159259540 |
| Molecular Formula | C32H31ClO9 |
| Molecular Weight | 595.04 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | 3,5-dimethoxy-4-phenylmethoxybenzoic acid;3,5-dimethoxy-4-phenylmethoxybenzoyl chloride |
| SMILES | COc1cc(C(=O)Cl)cc(OC)c1OCc1ccccc1.COc1cc(C(=O)O)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C16H15ClO4.C16H16O5/c2*1-19-13-8-12(16(17)18)9-14(20-2)15(13)21-10-11-6-4-3-5-7-11/h3-9H,10H2,1-2H3;3-9H,10H2,1-2H3,(H,17,18) |
| InChIKey | KWIHUSLDCJAMGC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.04 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|