C18H20O7 — CID 24899884
3,5-bis(methoxymethoxy)-4-phenylmethoxybenzoic acid (PubChem CID 24899884) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is 3,5-bis(methoxymethoxy)-4-phenylmethoxybenzoic acid.
| Compound Name | 3,5-bis(methoxymethoxy)-4-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 24899884 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 3,5-bis(methoxymethoxy)-4-phenylmethoxybenzoic acid |
| SMILES | COCOc1cc(C(=O)O)cc(OCOC)c1OCc1ccccc1 |
| InChI | InChI=1S/C18H20O7/c1-21-11-24-15-8-14(18(19)20)9-16(25-12-22-2)17(15)23-10-13-6-4-3-5-7-13/h3-9H,10-12H2,1-2H3,(H,19,20) |
| InChIKey | WTUSOTXTDGFPTO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|