C43H46O8 — CID 158298213
2,2-dimethyl-1-(3,4,5-trihydroxyphenyl)propan-1-one;2,2-dimethyl-1-[3,4,5-tris(phenylmethoxy)phenyl]propan-1-one (PubChem CID 158298213) has the molecular formula C43H46O8 and a molecular weight of 690.83 g/mol. Its IUPAC name is 2,2-dimethyl-1-(3,4,5-trihydroxyphenyl)propan-1-one;2,2-dimethyl-1-[3,4,5-tris(phenylmethoxy)phenyl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-(3,4,5-trihydroxyphenyl)propan-1-one;2,2-dimethyl-1-[3,4,5-tris(phenylmethoxy)phenyl]propan-1-one |
|---|---|
| PubChem CID | 158298213 |
| Molecular Formula | C43H46O8 |
| Molecular Weight | 690.83 g/mol |
| Exact Mass | 690.32 |
| IUPAC Name | 2,2-dimethyl-1-(3,4,5-trihydroxyphenyl)propan-1-one;2,2-dimethyl-1-[3,4,5-tris(phenylmethoxy)phenyl]propan-1-one |
| SMILES | CC(C)(C)C(=O)c1cc(O)c(O)c(O)c1.CC(C)(C)C(=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H32O4.C11H14O4/c1-32(2,3)31(33)27-19-28(34-21-24-13-7-4-8-14-24)30(36-23-26-17-11-6-12-18-26)29(20-27)35-22-25-15-9-5-10-16-25;1-11(2,3)10(15)6-4-7(12)9(14)8(13)5-6/h4-20H,21-23H2,1-3H3;4-5,12-14H,1-3H3 |
| InChIKey | GMEFBDNMPJMLTD-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.83 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|