C16H15ClO5 — CID 59303396
4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid (PubChem CID 59303396) has the molecular formula C16H15ClO5 and a molecular weight of 322.74 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid.
| Compound Name | 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 59303396 |
| Molecular Formula | C16H15ClO5 |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(OC)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H15ClO5/c1-20-13-7-11(16(18)19)8-14(21-2)15(13)22-9-10-4-3-5-12(17)6-10/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | BJYITOYSISBTJK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |