4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid

C16H15ClO5 — CID 59303396

IUPAC4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid
SMILESCOc1cc(C(=O)O)cc(OC)c1OCc1cccc(Cl)c1
InChIInChI=1S/C16H15ClO5/c1-20-13-7-11(16(18)19)8-14(21-2)15(13)22-9-10-4-3-5-12(17)6-10/h3-8H,9H2,1-2H3,(H,18,19)
InChIKeyBJYITOYSISBTJK-UHFFFAOYSA-N
MW322.74 g/mol
LogP3.63
Rot. Bonds6

About 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid

4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid (PubChem CID 59303396) has the molecular formula C16H15ClO5 and a molecular weight of 322.74 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid.

Molecular Properties

Compound Name4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid
PubChem CID59303396
Molecular FormulaC16H15ClO5
Molecular Weight322.74 g/mol
Exact Mass322.06
IUPAC Name4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid
SMILESCOc1cc(C(=O)O)cc(OC)c1OCc1cccc(Cl)c1
InChIInChI=1S/C16H15ClO5/c1-20-13-7-11(16(18)19)8-14(21-2)15(13)22-9-10-4-3-5-12(17)6-10/h3-8H,9H2,1-2H3,(H,18,19)
InChIKeyBJYITOYSISBTJK-UHFFFAOYSA-N
XLogP3.63
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.74
LogP ≤ 53.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid?
The IUPAC name of 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid (CID 59303396) is 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid.
What is the SMILES notation for 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid?
The canonical SMILES for 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid is COc1cc(C(=O)O)cc(OC)c1OCc1cccc(Cl)c1.
What is the InChIKey of 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid?
The InChIKey is BJYITOYSISBTJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClO5/c1-20-13-7-11(16(18)19)8-14(21-2)15(13)22-9-10-4-3-5-12(17)6-10/h3-8H,9H2,1-2H3,(H,18,19).
What are the key properties of 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid?
4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid has a molecular weight of 322.74 g/mol, XLogP of 3.63, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-chlorophenyl)methoxy]-3,5-dimethoxybenzoic acid is sourced from PubChem (CID 59303396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).