C22H19BrClNO4 — CID 66543621
4-[[6-bromo-2-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]benzoic acid (PubChem CID 66543621) has the molecular formula C22H19BrClNO4 and a molecular weight of 476.75 g/mol. Its IUPAC name is 4-[[6-bromo-2-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]benzoic acid.
| Compound Name | 4-[[6-bromo-2-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 66543621 |
| Molecular Formula | C22H19BrClNO4 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | 4-[[6-bromo-2-[(3-chlorophenyl)methoxy]-3-methoxyphenyl]methylamino]benzoic acid |
| SMILES | COc1ccc(Br)c(CNc2ccc(C(=O)O)cc2)c1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H19BrClNO4/c1-28-20-10-9-19(23)18(12-25-17-7-5-15(6-8-17)22(26)27)21(20)29-13-14-3-2-4-16(24)11-14/h2-11,25H,12-13H2,1H3,(H,26,27) |
| InChIKey | IVZUZGNNGDBMTR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |