C16H15BrO5 — CID 22681001
3-[(4-bromo-2,6-dimethoxyphenoxy)methyl]benzoic acid (PubChem CID 22681001) has the molecular formula C16H15BrO5 and a molecular weight of 367.20 g/mol. Its IUPAC name is 3-[(4-bromo-2,6-dimethoxyphenoxy)methyl]benzoic acid.
| Compound Name | 3-[(4-bromo-2,6-dimethoxyphenoxy)methyl]benzoic acid |
|---|---|
| PubChem CID | 22681001 |
| Molecular Formula | C16H15BrO5 |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 3-[(4-bromo-2,6-dimethoxyphenoxy)methyl]benzoic acid |
| SMILES | COc1cc(Br)cc(OC)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C16H15BrO5/c1-20-13-7-12(17)8-14(21-2)15(13)22-9-10-4-3-5-11(6-10)16(18)19/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | JRGWPVSTWXUUQV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |