C15H12Cl2O4 — CID 8706920
3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxybenzoic acid (PubChem CID 8706920) has the molecular formula C15H12Cl2O4 and a molecular weight of 327.16 g/mol. Its IUPAC name is 3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxybenzoic acid.
| Compound Name | 3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 8706920 |
| Molecular Formula | C15H12Cl2O4 |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 3-chloro-4-[(4-chlorophenyl)methoxy]-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(Cl)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12Cl2O4/c1-20-13-7-10(15(18)19)6-12(17)14(13)21-8-9-2-4-11(16)5-3-9/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | UZAIZRXLNZTLLD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |