C20H27O3P — CID 71039658
2-(3,5-dimethoxy-2-phenylmethoxyphenyl)butan-2-yl-methylphosphane (PubChem CID 71039658) has the molecular formula C20H27O3P and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-(3,5-dimethoxy-2-phenylmethoxyphenyl)butan-2-yl-methylphosphane.
| Compound Name | 2-(3,5-dimethoxy-2-phenylmethoxyphenyl)butan-2-yl-methylphosphane |
|---|---|
| PubChem CID | 71039658 |
| Molecular Formula | C20H27O3P |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-(3,5-dimethoxy-2-phenylmethoxyphenyl)butan-2-yl-methylphosphane |
| SMILES | CCC(C)(PC)c1cc(OC)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C20H27O3P/c1-6-20(2,24-5)17-12-16(21-3)13-18(22-4)19(17)23-14-15-10-8-7-9-11-15/h7-13,24H,6,14H2,1-5H3 |
| InChIKey | NJANWPLUSVFRIY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|