C25H27O3P — CID 88969071
2-[2-(3-methoxy-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]benzaldehyde (PubChem CID 88969071) has the molecular formula C25H27O3P and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-[2-(3-methoxy-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]benzaldehyde.
| Compound Name | 2-[2-(3-methoxy-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]benzaldehyde |
|---|---|
| PubChem CID | 88969071 |
| Molecular Formula | C25H27O3P |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-[2-(3-methoxy-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]benzaldehyde |
| SMILES | CCC(C)(Pc1ccccc1C=O)c1cccc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H27O3P/c1-4-25(2,29-23-16-9-8-13-20(23)17-26)21-14-10-15-22(27-3)24(21)28-18-19-11-6-5-7-12-19/h5-17,29H,4,18H2,1-3H3 |
| InChIKey | RSCDTYHYRTVJSE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|