C24H25O2P — CID 88987570
2-[2-(3-benzyl-2-hydroxyphenyl)butan-2-ylphosphanyl]benzaldehyde (PubChem CID 88987570) has the molecular formula C24H25O2P and a molecular weight of 376.44 g/mol. Its IUPAC name is 2-[2-(3-benzyl-2-hydroxyphenyl)butan-2-ylphosphanyl]benzaldehyde.
| Compound Name | 2-[2-(3-benzyl-2-hydroxyphenyl)butan-2-ylphosphanyl]benzaldehyde |
|---|---|
| PubChem CID | 88987570 |
| Molecular Formula | C24H25O2P |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-[2-(3-benzyl-2-hydroxyphenyl)butan-2-ylphosphanyl]benzaldehyde |
| SMILES | CCC(C)(Pc1ccccc1C=O)c1cccc(Cc2ccccc2)c1O |
| InChI | InChI=1S/C24H25O2P/c1-3-24(2,27-22-15-8-7-12-20(22)17-25)21-14-9-13-19(23(21)26)16-18-10-5-4-6-11-18/h4-15,17,26-27H,3,16H2,1-2H3 |
| InChIKey | GPYMQFBBABJDBW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|