C26H32NOP — CID 70807553
2-benzyl-6-[2-[2-(dimethylamino)-6-methylphenyl]phosphanylbutan-2-yl]phenol (PubChem CID 70807553) has the molecular formula C26H32NOP and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-benzyl-6-[2-[2-(dimethylamino)-6-methylphenyl]phosphanylbutan-2-yl]phenol.
| Compound Name | 2-benzyl-6-[2-[2-(dimethylamino)-6-methylphenyl]phosphanylbutan-2-yl]phenol |
|---|---|
| PubChem CID | 70807553 |
| Molecular Formula | C26H32NOP |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 2-benzyl-6-[2-[2-(dimethylamino)-6-methylphenyl]phosphanylbutan-2-yl]phenol |
| SMILES | CCC(C)(Pc1c(C)cccc1N(C)C)c1cccc(Cc2ccccc2)c1O |
| InChI | InChI=1S/C26H32NOP/c1-6-26(3,29-25-19(2)12-10-17-23(25)27(4)5)22-16-11-15-21(24(22)28)18-20-13-8-7-9-14-20/h7-17,28-29H,6,18H2,1-5H3 |
| InChIKey | YHRJYLZAUSZRSY-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|