C34H48NOP — CID 89214353
2-[2-[2-[[benzyl(methyl)amino]methyl]-6-methylphenyl]phosphanylbutan-2-yl]-4,6-ditert-butylphenol (PubChem CID 89214353) has the molecular formula C34H48NOP and a molecular weight of 517.74 g/mol. Its IUPAC name is 2-[2-[2-[[benzyl(methyl)amino]methyl]-6-methylphenyl]phosphanylbutan-2-yl]-4,6-ditert-butylphenol.
| Compound Name | 2-[2-[2-[[benzyl(methyl)amino]methyl]-6-methylphenyl]phosphanylbutan-2-yl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 89214353 |
| Molecular Formula | C34H48NOP |
| Molecular Weight | 517.74 g/mol |
| Exact Mass | 517.35 |
| IUPAC Name | 2-[2-[2-[[benzyl(methyl)amino]methyl]-6-methylphenyl]phosphanylbutan-2-yl]-4,6-ditert-butylphenol |
| SMILES | CCC(C)(Pc1c(C)cccc1CN(C)Cc1ccccc1)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C34H48NOP/c1-11-34(9,29-21-27(32(3,4)5)20-28(30(29)36)33(6,7)8)37-31-24(2)16-15-19-26(31)23-35(10)22-25-17-13-12-14-18-25/h12-21,36-37H,11,22-23H2,1-10H3 |
| InChIKey | DOCUZKFXTRBOCM-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.74 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|