C21H24F5OP — CID 89214517
4-tert-butyl-2-methyl-6-[2-(2,3,4,5,6-pentafluorophenyl)phosphanylbutan-2-yl]phenol (PubChem CID 89214517) has the molecular formula C21H24F5OP and a molecular weight of 418.39 g/mol. Its IUPAC name is 4-tert-butyl-2-methyl-6-[2-(2,3,4,5,6-pentafluorophenyl)phosphanylbutan-2-yl]phenol.
| Compound Name | 4-tert-butyl-2-methyl-6-[2-(2,3,4,5,6-pentafluorophenyl)phosphanylbutan-2-yl]phenol |
|---|---|
| PubChem CID | 89214517 |
| Molecular Formula | C21H24F5OP |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 4-tert-butyl-2-methyl-6-[2-(2,3,4,5,6-pentafluorophenyl)phosphanylbutan-2-yl]phenol |
| SMILES | CCC(C)(Pc1c(F)c(F)c(F)c(F)c1F)c1cc(C(C)(C)C)cc(C)c1O |
| InChI | InChI=1S/C21H24F5OP/c1-7-21(6,12-9-11(20(3,4)5)8-10(2)18(12)27)28-19-16(25)14(23)13(22)15(24)17(19)26/h8-9,27-28H,7H2,1-6H3 |
| InChIKey | UNKSRNUSFMIAEA-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|