C29H46NOP — CID 71191515
4-tert-butyl-2-[2-[2-[di(propan-2-yl)amino]-6-methylphenyl]phosphanylpentan-2-yl]-6-methylphenol (PubChem CID 71191515) has the molecular formula C29H46NOP and a molecular weight of 455.67 g/mol. Its IUPAC name is 4-tert-butyl-2-[2-[2-[di(propan-2-yl)amino]-6-methylphenyl]phosphanylpentan-2-yl]-6-methylphenol.
| Compound Name | 4-tert-butyl-2-[2-[2-[di(propan-2-yl)amino]-6-methylphenyl]phosphanylpentan-2-yl]-6-methylphenol |
|---|---|
| PubChem CID | 71191515 |
| Molecular Formula | C29H46NOP |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.33 |
| IUPAC Name | 4-tert-butyl-2-[2-[2-[di(propan-2-yl)amino]-6-methylphenyl]phosphanylpentan-2-yl]-6-methylphenol |
| SMILES | CCCC(C)(Pc1c(C)cccc1N(C(C)C)C(C)C)c1cc(C(C)(C)C)cc(C)c1O |
| InChI | InChI=1S/C29H46NOP/c1-12-16-29(11,24-18-23(28(8,9)10)17-22(7)26(24)31)32-27-21(6)14-13-15-25(27)30(19(2)3)20(4)5/h13-15,17-20,31-32H,12,16H2,1-11H3 |
| InChIKey | RLRUCYANEQOEFI-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|