C26H40NOP — CID 71191702
2-[3-[2-[di(propan-2-yl)amino]-6-methylphenyl]phosphanylhexan-3-yl]-4-methylphenol (PubChem CID 71191702) has the molecular formula C26H40NOP and a molecular weight of 413.59 g/mol. Its IUPAC name is 2-[3-[2-[di(propan-2-yl)amino]-6-methylphenyl]phosphanylhexan-3-yl]-4-methylphenol.
| Compound Name | 2-[3-[2-[di(propan-2-yl)amino]-6-methylphenyl]phosphanylhexan-3-yl]-4-methylphenol |
|---|---|
| PubChem CID | 71191702 |
| Molecular Formula | C26H40NOP |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 2-[3-[2-[di(propan-2-yl)amino]-6-methylphenyl]phosphanylhexan-3-yl]-4-methylphenol |
| SMILES | CCCC(CC)(Pc1c(C)cccc1N(C(C)C)C(C)C)c1cc(C)ccc1O |
| InChI | InChI=1S/C26H40NOP/c1-9-16-26(10-2,22-17-20(7)14-15-24(22)28)29-25-21(8)12-11-13-23(25)27(18(3)4)19(5)6/h11-15,17-19,28-29H,9-10,16H2,1-8H3 |
| InChIKey | RUIGIKLVBVPSDO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|