C31H40NO2P — CID 89356303
1-[2-[3-[2-(methoxymethoxy)-3,5-dimethylphenyl]hexan-3-ylphosphanyl]-3-methylphenyl]-N-phenylethanimine (PubChem CID 89356303) has the molecular formula C31H40NO2P and a molecular weight of 489.64 g/mol. Its IUPAC name is 1-[2-[3-[2-(methoxymethoxy)-3,5-dimethylphenyl]hexan-3-ylphosphanyl]-3-methylphenyl]-N-phenylethanimine.
| Compound Name | 1-[2-[3-[2-(methoxymethoxy)-3,5-dimethylphenyl]hexan-3-ylphosphanyl]-3-methylphenyl]-N-phenylethanimine |
|---|---|
| PubChem CID | 89356303 |
| Molecular Formula | C31H40NO2P |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | 1-[2-[3-[2-(methoxymethoxy)-3,5-dimethylphenyl]hexan-3-ylphosphanyl]-3-methylphenyl]-N-phenylethanimine |
| SMILES | CCCC(CC)(Pc1c(C)cccc1/C(C)=N\c1ccccc1)c1cc(C)cc(C)c1OCOC |
| InChI | InChI=1S/C31H40NO2P/c1-8-18-31(9-2,28-20-22(3)19-24(5)29(28)34-21-33-7)35-30-23(4)14-13-17-27(30)25(6)32-26-15-11-10-12-16-26/h10-17,19-20,35H,8-9,18,21H2,1-7H3/b32-25- |
| InChIKey | ZPWQOCJJLYSAEZ-MKCFTUBBSA-N |
| XLogP | 8.14 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|