C36H42NOP — CID 89356451
1-[2-[3-(3,5-dimethyl-2-phenylmethoxyphenyl)hexan-3-ylphosphanyl]-3-methylphenyl]-N-phenylethanimine (PubChem CID 89356451) has the molecular formula C36H42NOP and a molecular weight of 535.71 g/mol. Its IUPAC name is 1-[2-[3-(3,5-dimethyl-2-phenylmethoxyphenyl)hexan-3-ylphosphanyl]-3-methylphenyl]-N-phenylethanimine.
| Compound Name | 1-[2-[3-(3,5-dimethyl-2-phenylmethoxyphenyl)hexan-3-ylphosphanyl]-3-methylphenyl]-N-phenylethanimine |
|---|---|
| PubChem CID | 89356451 |
| Molecular Formula | C36H42NOP |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.30 |
| IUPAC Name | 1-[2-[3-(3,5-dimethyl-2-phenylmethoxyphenyl)hexan-3-ylphosphanyl]-3-methylphenyl]-N-phenylethanimine |
| SMILES | CCCC(CC)(Pc1c(C)cccc1/C(C)=N\c1ccccc1)c1cc(C)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C36H42NOP/c1-7-22-36(8-2,33-24-26(3)23-28(5)34(33)38-25-30-17-11-9-12-18-30)39-35-27(4)16-15-21-32(35)29(6)37-31-19-13-10-14-20-31/h9-21,23-24,39H,7-8,22,25H2,1-6H3/b37-29- |
| InChIKey | YONIBIDCEYRTBO-GPFIVKHLSA-N |
| XLogP | 9.74 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|