C37H38OP2 — CID 89214692
[2-[2-(3,5-dimethyl-2-phenylmethoxyphenyl)propan-2-ylphosphanyl]-3-methylphenyl]-diphenylphosphane (PubChem CID 89214692) has the molecular formula C37H38OP2 and a molecular weight of 560.66 g/mol. Its IUPAC name is [2-[2-(3,5-dimethyl-2-phenylmethoxyphenyl)propan-2-ylphosphanyl]-3-methylphenyl]-diphenylphosphane.
| Compound Name | [2-[2-(3,5-dimethyl-2-phenylmethoxyphenyl)propan-2-ylphosphanyl]-3-methylphenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 89214692 |
| Molecular Formula | C37H38OP2 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | [2-[2-(3,5-dimethyl-2-phenylmethoxyphenyl)propan-2-ylphosphanyl]-3-methylphenyl]-diphenylphosphane |
| SMILES | Cc1cc(C)c(OCc2ccccc2)c(C(C)(C)Pc2c(C)cccc2P(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C37H38OP2/c1-27-24-29(3)35(38-26-30-17-9-6-10-18-30)33(25-27)37(4,5)39-36-28(2)16-15-23-34(36)40(31-19-11-7-12-20-31)32-21-13-8-14-22-32/h6-25,39H,26H2,1-5H3 |
| InChIKey | UOFPMUQWTDQGDN-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|