C29H36NOP — CID 71039911
2-(3-methyl-2-phenylmethoxyphenyl)propan-2-yl-(4-methyl-2-piperidin-1-ylphenyl)phosphane (PubChem CID 71039911) has the molecular formula C29H36NOP and a molecular weight of 445.59 g/mol. Its IUPAC name is 2-(3-methyl-2-phenylmethoxyphenyl)propan-2-yl-(4-methyl-2-piperidin-1-ylphenyl)phosphane.
| Compound Name | 2-(3-methyl-2-phenylmethoxyphenyl)propan-2-yl-(4-methyl-2-piperidin-1-ylphenyl)phosphane |
|---|---|
| PubChem CID | 71039911 |
| Molecular Formula | C29H36NOP |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 2-(3-methyl-2-phenylmethoxyphenyl)propan-2-yl-(4-methyl-2-piperidin-1-ylphenyl)phosphane |
| SMILES | Cc1ccc(PC(C)(C)c2cccc(C)c2OCc2ccccc2)c(N2CCCCC2)c1 |
| InChI | InChI=1S/C29H36NOP/c1-22-16-17-27(26(20-22)30-18-9-6-10-19-30)32-29(3,4)25-15-11-12-23(2)28(25)31-21-24-13-7-5-8-14-24/h5,7-8,11-17,20,32H,6,9-10,18-19,21H2,1-4H3 |
| InChIKey | MZFXLBRZXMXXCP-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|