C23H32NO2P — CID 89214358
2-[2-(methoxymethoxy)phenyl]propan-2-yl-(4-methyl-2-piperidin-1-ylphenyl)phosphane (PubChem CID 89214358) has the molecular formula C23H32NO2P and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-[2-(methoxymethoxy)phenyl]propan-2-yl-(4-methyl-2-piperidin-1-ylphenyl)phosphane.
| Compound Name | 2-[2-(methoxymethoxy)phenyl]propan-2-yl-(4-methyl-2-piperidin-1-ylphenyl)phosphane |
|---|---|
| PubChem CID | 89214358 |
| Molecular Formula | C23H32NO2P |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2-[2-(methoxymethoxy)phenyl]propan-2-yl-(4-methyl-2-piperidin-1-ylphenyl)phosphane |
| SMILES | COCOc1ccccc1C(C)(C)Pc1ccc(C)cc1N1CCCCC1 |
| InChI | InChI=1S/C23H32NO2P/c1-18-12-13-22(20(16-18)24-14-8-5-9-15-24)27-23(2,3)19-10-6-7-11-21(19)26-17-25-4/h6-7,10-13,16,27H,5,8-9,14-15,17H2,1-4H3 |
| InChIKey | NELOOWUWLJZAEP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|