C21H26F3O2P — CID 89214352
2-[2-(methoxymethoxy)-5-methylphenyl]butan-2-yl-[4-methyl-2-(trifluoromethyl)phenyl]phosphane (PubChem CID 89214352) has the molecular formula C21H26F3O2P and a molecular weight of 398.41 g/mol. Its IUPAC name is 2-[2-(methoxymethoxy)-5-methylphenyl]butan-2-yl-[4-methyl-2-(trifluoromethyl)phenyl]phosphane.
| Compound Name | 2-[2-(methoxymethoxy)-5-methylphenyl]butan-2-yl-[4-methyl-2-(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 89214352 |
| Molecular Formula | C21H26F3O2P |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[2-(methoxymethoxy)-5-methylphenyl]butan-2-yl-[4-methyl-2-(trifluoromethyl)phenyl]phosphane |
| SMILES | CCC(C)(Pc1ccc(C)cc1C(F)(F)F)c1cc(C)ccc1OCOC |
| InChI | InChI=1S/C21H26F3O2P/c1-6-20(4,16-11-14(2)7-9-18(16)26-13-25-5)27-19-10-8-15(3)12-17(19)21(22,23)24/h7-12,27H,6,13H2,1-5H3 |
| InChIKey | NUEKYGMLCVGKIZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|