C22H31O3P — CID 89214388
1-[2-[2-[2-(methoxymethoxy)-3-methylphenyl]butan-2-ylphosphanyl]-5-methylphenyl]ethanol (PubChem CID 89214388) has the molecular formula C22H31O3P and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-[2-[2-[2-(methoxymethoxy)-3-methylphenyl]butan-2-ylphosphanyl]-5-methylphenyl]ethanol.
| Compound Name | 1-[2-[2-[2-(methoxymethoxy)-3-methylphenyl]butan-2-ylphosphanyl]-5-methylphenyl]ethanol |
|---|---|
| PubChem CID | 89214388 |
| Molecular Formula | C22H31O3P |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-[2-[2-[2-(methoxymethoxy)-3-methylphenyl]butan-2-ylphosphanyl]-5-methylphenyl]ethanol |
| SMILES | CCC(C)(Pc1ccc(C)cc1C(C)O)c1cccc(C)c1OCOC |
| InChI | InChI=1S/C22H31O3P/c1-7-22(5,19-10-8-9-16(3)21(19)25-14-24-6)26-20-12-11-15(2)13-18(20)17(4)23/h8-13,17,23,26H,7,14H2,1-6H3 |
| InChIKey | GANVUXRWXHIEJD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|