C27H42NO2P — CID 89356601
N-[[2-[2-[2-(methoxymethoxy)-3-methylphenyl]butan-2-ylphosphanyl]-3-methylphenyl]methyl]-N-propan-2-ylpropan-2-amine (PubChem CID 89356601) has the molecular formula C27H42NO2P and a molecular weight of 443.61 g/mol. Its IUPAC name is N-[[2-[2-[2-(methoxymethoxy)-3-methylphenyl]butan-2-ylphosphanyl]-3-methylphenyl]methyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[[2-[2-[2-(methoxymethoxy)-3-methylphenyl]butan-2-ylphosphanyl]-3-methylphenyl]methyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 89356601 |
| Molecular Formula | C27H42NO2P |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | N-[[2-[2-[2-(methoxymethoxy)-3-methylphenyl]butan-2-ylphosphanyl]-3-methylphenyl]methyl]-N-propan-2-ylpropan-2-amine |
| SMILES | CCC(C)(Pc1c(C)cccc1CN(C(C)C)C(C)C)c1cccc(C)c1OCOC |
| InChI | InChI=1S/C27H42NO2P/c1-10-27(8,24-16-12-13-21(6)25(24)30-18-29-9)31-26-22(7)14-11-15-23(26)17-28(19(2)3)20(4)5/h11-16,19-20,31H,10,17-18H2,1-9H3 |
| InChIKey | ANHBSPDMCLKJHP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|