C33H54NO2P — CID 89214643
N-[[2-[2-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]hexan-2-ylphosphanyl]-3-methylphenyl]methyl]-N-propan-2-ylpropan-2-amine (PubChem CID 89214643) has the molecular formula C33H54NO2P and a molecular weight of 527.77 g/mol. Its IUPAC name is N-[[2-[2-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]hexan-2-ylphosphanyl]-3-methylphenyl]methyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[[2-[2-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]hexan-2-ylphosphanyl]-3-methylphenyl]methyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 89214643 |
| Molecular Formula | C33H54NO2P |
| Molecular Weight | 527.77 g/mol |
| Exact Mass | 527.39 |
| IUPAC Name | N-[[2-[2-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]hexan-2-ylphosphanyl]-3-methylphenyl]methyl]-N-propan-2-ylpropan-2-amine |
| SMILES | CCCCC(C)(Pc1c(C)cccc1CN(C(C)C)C(C)C)c1cc(C(C)(C)C)cc(C)c1OCOC |
| InChI | InChI=1S/C33H54NO2P/c1-13-14-18-33(11,29-20-28(32(8,9)10)19-26(7)30(29)36-22-35-12)37-31-25(6)16-15-17-27(31)21-34(23(2)3)24(4)5/h15-17,19-20,23-24,37H,13-14,18,21-22H2,1-12H3 |
| InChIKey | SNRXLEXSBANXKU-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.77 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|