C29H46NO2P — CID 89214597
1-[2-[2-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]hexan-2-ylphosphanyl]-5-methylphenyl]-N,N-dimethylmethanamine (PubChem CID 89214597) has the molecular formula C29H46NO2P and a molecular weight of 471.67 g/mol. Its IUPAC name is 1-[2-[2-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]hexan-2-ylphosphanyl]-5-methylphenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-[2-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]hexan-2-ylphosphanyl]-5-methylphenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 89214597 |
| Molecular Formula | C29H46NO2P |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | 1-[2-[2-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]hexan-2-ylphosphanyl]-5-methylphenyl]-N,N-dimethylmethanamine |
| SMILES | CCCCC(C)(Pc1ccc(C)cc1CN(C)C)c1cc(C(C)(C)C)cc(C)c1OCOC |
| InChI | InChI=1S/C29H46NO2P/c1-11-12-15-29(7,33-26-14-13-21(2)16-23(26)19-30(8)9)25-18-24(28(4,5)6)17-22(3)27(25)32-20-31-10/h13-14,16-18,33H,11-12,15,19-20H2,1-10H3 |
| InChIKey | RUXSKIUPFCDFHQ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|