C24H35O2P — CID 70807329
4-tert-butyl-2-[(2R)-2-[2-(hydroxymethyl)-4-methylphenyl]phosphanylpentan-2-yl]-6-methylphenol (PubChem CID 70807329) has the molecular formula C24H35O2P and a molecular weight of 386.52 g/mol. Its IUPAC name is 4-tert-butyl-2-[(2R)-2-[2-(hydroxymethyl)-4-methylphenyl]phosphanylpentan-2-yl]-6-methylphenol.
| Compound Name | 4-tert-butyl-2-[(2R)-2-[2-(hydroxymethyl)-4-methylphenyl]phosphanylpentan-2-yl]-6-methylphenol |
|---|---|
| PubChem CID | 70807329 |
| Molecular Formula | C24H35O2P |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4-tert-butyl-2-[(2R)-2-[2-(hydroxymethyl)-4-methylphenyl]phosphanylpentan-2-yl]-6-methylphenol |
| SMILES | CCC[C@@](C)(Pc1ccc(C)cc1CO)c1cc(C(C)(C)C)cc(C)c1O |
| InChI | InChI=1S/C24H35O2P/c1-8-11-24(7,27-21-10-9-16(2)12-18(21)15-25)20-14-19(23(4,5)6)13-17(3)22(20)26/h9-10,12-14,25-27H,8,11,15H2,1-7H3/t24-/m1/s1 |
| InChIKey | ASJRAFXECYWLRG-XMMPIXPASA-N |
| XLogP | 5.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|