C28H42NOP — CID 71191539
4-tert-butyl-2-methyl-6-[3-[4-methyl-2-(methyliminomethyl)phenyl]phosphanyloctan-3-yl]phenol (PubChem CID 71191539) has the molecular formula C28H42NOP and a molecular weight of 439.62 g/mol. Its IUPAC name is 4-tert-butyl-2-methyl-6-[3-[4-methyl-2-(methyliminomethyl)phenyl]phosphanyloctan-3-yl]phenol.
| Compound Name | 4-tert-butyl-2-methyl-6-[3-[4-methyl-2-(methyliminomethyl)phenyl]phosphanyloctan-3-yl]phenol |
|---|---|
| PubChem CID | 71191539 |
| Molecular Formula | C28H42NOP |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | 4-tert-butyl-2-methyl-6-[3-[4-methyl-2-(methyliminomethyl)phenyl]phosphanyloctan-3-yl]phenol |
| SMILES | CCCCCC(CC)(Pc1ccc(C)cc1/C=N\C)c1cc(C(C)(C)C)cc(C)c1O |
| InChI | InChI=1S/C28H42NOP/c1-9-11-12-15-28(10-2,31-25-14-13-20(3)16-22(25)19-29-8)24-18-23(27(5,6)7)17-21(4)26(24)30/h13-14,16-19,30-31H,9-12,15H2,1-8H3/b29-19- |
| InChIKey | JXCKZSUSXGPYJI-CEUNXORHSA-N |
| XLogP | 7.54 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|