C30H45FNOP — CID 89356185
2,4-ditert-butyl-6-[3-[4-fluoro-2-(methyliminomethyl)phenyl]phosphanyloctan-3-yl]phenol (PubChem CID 89356185) has the molecular formula C30H45FNOP and a molecular weight of 485.67 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[3-[4-fluoro-2-(methyliminomethyl)phenyl]phosphanyloctan-3-yl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[3-[4-fluoro-2-(methyliminomethyl)phenyl]phosphanyloctan-3-yl]phenol |
|---|---|
| PubChem CID | 89356185 |
| Molecular Formula | C30H45FNOP |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | 2,4-ditert-butyl-6-[3-[4-fluoro-2-(methyliminomethyl)phenyl]phosphanyloctan-3-yl]phenol |
| SMILES | CCCCCC(CC)(Pc1ccc(F)cc1/C=N\C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H45FNOP/c1-10-12-13-16-30(11-2,34-26-15-14-23(31)17-21(26)20-32-9)25-19-22(28(3,4)5)18-24(27(25)33)29(6,7)8/h14-15,17-20,33-34H,10-13,16H2,1-9H3/b32-20- |
| InChIKey | JBKHOTQNPXSBJR-RGXNXFOYSA-N |
| XLogP | 8.36 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|