C33H51O3P — CID 89356463
1-[2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]-5-methylphenyl]ethanone (PubChem CID 89356463) has the molecular formula C33H51O3P and a molecular weight of 526.74 g/mol. Its IUPAC name is 1-[2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]-5-methylphenyl]ethanone.
| Compound Name | 1-[2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]-5-methylphenyl]ethanone |
|---|---|
| PubChem CID | 89356463 |
| Molecular Formula | C33H51O3P |
| Molecular Weight | 526.74 g/mol |
| Exact Mass | 526.36 |
| IUPAC Name | 1-[2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]-5-methylphenyl]ethanone |
| SMILES | CCCCCC(CC)(Pc1ccc(C)cc1C(C)=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OCOC |
| InChI | InChI=1S/C33H51O3P/c1-12-14-15-18-33(13-2,37-29-17-16-23(3)19-26(29)24(4)34)28-21-25(31(5,6)7)20-27(32(8,9)10)30(28)36-22-35-11/h16-17,19-21,37H,12-15,18,22H2,1-11H3 |
| InChIKey | MXVJVIUNXYGXSR-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.74 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|