About 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde
2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde (PubChem CID 89356589) has the molecular formula C31H47O3P
and a molecular weight of 498.69 g/mol. Its IUPAC name is 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde.
Molecular Properties
| Compound Name | 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde |
| PubChem CID | 89356589 |
| Molecular Formula | C31H47O3P |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde |
| SMILES | CCCCCC(CC)(Pc1ccccc1C=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OCOC |
| InChI | InChI=1S/C31H47O3P/c1-10-12-15-18-31(11-2,35-27-17-14-13-16-23(27)21-32)26-20-24(29(3,4)5)19-25(30(6,7)8)28(26)34-22-33-9/h13-14,16-17,19-21,35H,10-12,15,18,22H2,1-9H3 |
| InChIKey | BSZLSHINXIMJDC-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde?
The IUPAC name of 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde (CID 89356589) is 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde.
What is the SMILES notation for 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde?
The canonical SMILES for 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde is CCCCCC(CC)(Pc1ccccc1C=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OCOC.
What is the InChIKey of 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde?
The InChIKey is BSZLSHINXIMJDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H47O3P/c1-10-12-15-18-31(11-2,35-27-17-14-13-16-23(27)21-32)26-20-24(29(3,4)5)19-25(30(6,7)8)28(26)34-22-33-9/h13-14,16-17,19-21,35H,10-12,15,18,22H2,1-9H3.
What are the key properties of 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde?
2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde has a molecular weight of 498.69 g/mol, XLogP of 8.27, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]octan-3-ylphosphanyl]benzaldehyde is sourced from PubChem (CID 89356589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).