C26H38FO2P — CID 89214520
3-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]heptan-3-yl-(2-fluorophenyl)phosphane (PubChem CID 89214520) has the molecular formula C26H38FO2P and a molecular weight of 432.56 g/mol. Its IUPAC name is 3-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]heptan-3-yl-(2-fluorophenyl)phosphane.
| Compound Name | 3-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]heptan-3-yl-(2-fluorophenyl)phosphane |
|---|---|
| PubChem CID | 89214520 |
| Molecular Formula | C26H38FO2P |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | 3-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]heptan-3-yl-(2-fluorophenyl)phosphane |
| SMILES | CCCCC(CC)(Pc1ccccc1F)c1cc(C(C)(C)C)cc(C)c1OCOC |
| InChI | InChI=1S/C26H38FO2P/c1-8-10-15-26(9-2,30-23-14-12-11-13-22(23)27)21-17-20(25(4,5)6)16-19(3)24(21)29-18-28-7/h11-14,16-17,30H,8-10,15,18H2,1-7H3 |
| InChIKey | FYFWACSVFUDNAN-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|