C28H41O2P — CID 71191817
1-[2-[3-(5-tert-butyl-2-methoxy-3-methylphenyl)octan-3-ylphosphanyl]phenyl]ethanone (PubChem CID 71191817) has the molecular formula C28H41O2P and a molecular weight of 440.61 g/mol. Its IUPAC name is 1-[2-[3-(5-tert-butyl-2-methoxy-3-methylphenyl)octan-3-ylphosphanyl]phenyl]ethanone.
| Compound Name | 1-[2-[3-(5-tert-butyl-2-methoxy-3-methylphenyl)octan-3-ylphosphanyl]phenyl]ethanone |
|---|---|
| PubChem CID | 71191817 |
| Molecular Formula | C28H41O2P |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 1-[2-[3-(5-tert-butyl-2-methoxy-3-methylphenyl)octan-3-ylphosphanyl]phenyl]ethanone |
| SMILES | CCCCCC(CC)(Pc1ccccc1C(C)=O)c1cc(C(C)(C)C)cc(C)c1OC |
| InChI | InChI=1S/C28H41O2P/c1-9-11-14-17-28(10-2,31-25-16-13-12-15-23(25)21(4)29)24-19-22(27(5,6)7)18-20(3)26(24)30-8/h12-13,15-16,18-19,31H,9-11,14,17H2,1-8H3 |
| InChIKey | GNPQHTVEASDLBV-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|