C32H52NO2P — CID 89356666
2-[3-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]hexan-3-ylphosphanyl]-3-methyl-N,N-di(propan-2-yl)aniline (PubChem CID 89356666) has the molecular formula C32H52NO2P and a molecular weight of 513.75 g/mol. Its IUPAC name is 2-[3-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]hexan-3-ylphosphanyl]-3-methyl-N,N-di(propan-2-yl)aniline.
| Compound Name | 2-[3-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]hexan-3-ylphosphanyl]-3-methyl-N,N-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 89356666 |
| Molecular Formula | C32H52NO2P |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.37 |
| IUPAC Name | 2-[3-[5-tert-butyl-2-(methoxymethoxy)-3-methylphenyl]hexan-3-ylphosphanyl]-3-methyl-N,N-di(propan-2-yl)aniline |
| SMILES | CCCC(CC)(Pc1c(C)cccc1N(C(C)C)C(C)C)c1cc(C(C)(C)C)cc(C)c1OCOC |
| InChI | InChI=1S/C32H52NO2P/c1-13-18-32(14-2,27-20-26(31(9,10)11)19-25(8)29(27)35-21-34-12)36-30-24(7)16-15-17-28(30)33(22(3)4)23(5)6/h15-17,19-20,22-23,36H,13-14,18,21H2,1-12H3 |
| InChIKey | UNMFACPGTSLZDM-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|