C23H34NO3P — CID 89356665
2-[2-[3-methoxy-2-(methoxymethoxy)phenyl]pentan-2-ylphosphanyl]-N,N,3-trimethylaniline (PubChem CID 89356665) has the molecular formula C23H34NO3P and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-[2-[3-methoxy-2-(methoxymethoxy)phenyl]pentan-2-ylphosphanyl]-N,N,3-trimethylaniline.
| Compound Name | 2-[2-[3-methoxy-2-(methoxymethoxy)phenyl]pentan-2-ylphosphanyl]-N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 89356665 |
| Molecular Formula | C23H34NO3P |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 2-[2-[3-methoxy-2-(methoxymethoxy)phenyl]pentan-2-ylphosphanyl]-N,N,3-trimethylaniline |
| SMILES | CCCC(C)(Pc1c(C)cccc1N(C)C)c1cccc(OC)c1OCOC |
| InChI | InChI=1S/C23H34NO3P/c1-8-15-23(3,28-22-17(2)11-9-13-19(22)24(4)5)18-12-10-14-20(26-7)21(18)27-16-25-6/h9-14,28H,8,15-16H2,1-7H3 |
| InChIKey | QQHQZIPZEAEDGG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|