C13H20ClO3P — CID 88969094
chloro-[2-[3-methoxy-2-(methoxymethoxy)phenyl]butan-2-yl]phosphane (PubChem CID 88969094) has the molecular formula C13H20ClO3P and a molecular weight of 290.73 g/mol. Its IUPAC name is chloro-[2-[3-methoxy-2-(methoxymethoxy)phenyl]butan-2-yl]phosphane.
| Compound Name | chloro-[2-[3-methoxy-2-(methoxymethoxy)phenyl]butan-2-yl]phosphane |
|---|---|
| PubChem CID | 88969094 |
| Molecular Formula | C13H20ClO3P |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | chloro-[2-[3-methoxy-2-(methoxymethoxy)phenyl]butan-2-yl]phosphane |
| SMILES | CCC(C)(PCl)c1cccc(OC)c1OCOC |
| InChI | InChI=1S/C13H20ClO3P/c1-5-13(2,18-14)10-7-6-8-11(16-4)12(10)17-9-15-3/h6-8,18H,5,9H2,1-4H3 |
| InChIKey | XLOBHUQNTKKOTB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|