C21H30NO2P — CID 89214490
1-[2-[2-[2-(methoxymethoxy)phenyl]butan-2-ylphosphanyl]phenyl]-N,N-dimethylmethanamine (PubChem CID 89214490) has the molecular formula C21H30NO2P and a molecular weight of 359.45 g/mol. Its IUPAC name is 1-[2-[2-[2-(methoxymethoxy)phenyl]butan-2-ylphosphanyl]phenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-[2-[2-(methoxymethoxy)phenyl]butan-2-ylphosphanyl]phenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 89214490 |
| Molecular Formula | C21H30NO2P |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 1-[2-[2-[2-(methoxymethoxy)phenyl]butan-2-ylphosphanyl]phenyl]-N,N-dimethylmethanamine |
| SMILES | CCC(C)(Pc1ccccc1CN(C)C)c1ccccc1OCOC |
| InChI | InChI=1S/C21H30NO2P/c1-6-21(2,18-12-8-9-13-19(18)24-16-23-5)25-20-14-10-7-11-17(20)15-22(3)4/h7-14,25H,6,15-16H2,1-5H3 |
| InChIKey | SSORACVOZXSJQI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|