C25H37O3P — CID 89214631
1-[2-[2-[3-tert-butyl-2-(methoxymethoxy)-5-methylphenyl]butan-2-ylphosphanyl]phenyl]ethanol (PubChem CID 89214631) has the molecular formula C25H37O3P and a molecular weight of 416.54 g/mol. Its IUPAC name is 1-[2-[2-[3-tert-butyl-2-(methoxymethoxy)-5-methylphenyl]butan-2-ylphosphanyl]phenyl]ethanol.
| Compound Name | 1-[2-[2-[3-tert-butyl-2-(methoxymethoxy)-5-methylphenyl]butan-2-ylphosphanyl]phenyl]ethanol |
|---|---|
| PubChem CID | 89214631 |
| Molecular Formula | C25H37O3P |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 1-[2-[2-[3-tert-butyl-2-(methoxymethoxy)-5-methylphenyl]butan-2-ylphosphanyl]phenyl]ethanol |
| SMILES | CCC(C)(Pc1ccccc1C(C)O)c1cc(C)cc(C(C)(C)C)c1OCOC |
| InChI | InChI=1S/C25H37O3P/c1-9-25(7,29-22-13-11-10-12-19(22)18(3)26)21-15-17(2)14-20(24(4,5)6)23(21)28-16-27-8/h10-15,18,26,29H,9,16H2,1-8H3 |
| InChIKey | HLVULLIZJAVXBD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|