C27H33O2P — CID 70807417
1-[2-[2-(3,5-dimethyl-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]phenyl]ethanol (PubChem CID 70807417) has the molecular formula C27H33O2P and a molecular weight of 420.53 g/mol. Its IUPAC name is 1-[2-[2-(3,5-dimethyl-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]phenyl]ethanol.
| Compound Name | 1-[2-[2-(3,5-dimethyl-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]phenyl]ethanol |
|---|---|
| PubChem CID | 70807417 |
| Molecular Formula | C27H33O2P |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-[2-[2-(3,5-dimethyl-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]phenyl]ethanol |
| SMILES | CCC(C)(Pc1ccccc1C(C)O)c1cc(C)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H33O2P/c1-6-27(5,30-25-15-11-10-14-23(25)21(4)28)24-17-19(2)16-20(3)26(24)29-18-22-12-8-7-9-13-22/h7-17,21,28,30H,6,18H2,1-5H3 |
| InChIKey | YDVKLFVWVXVNJV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|