C26H31O2P — CID 71039834
[5-methyl-2-[2-(5-methyl-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]phenyl]methanol (PubChem CID 71039834) has the molecular formula C26H31O2P and a molecular weight of 406.51 g/mol. Its IUPAC name is [5-methyl-2-[2-(5-methyl-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]phenyl]methanol.
| Compound Name | [5-methyl-2-[2-(5-methyl-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]phenyl]methanol |
|---|---|
| PubChem CID | 71039834 |
| Molecular Formula | C26H31O2P |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | [5-methyl-2-[2-(5-methyl-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]phenyl]methanol |
| SMILES | CCC(C)(Pc1ccc(C)cc1CO)c1cc(C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C26H31O2P/c1-5-26(4,29-25-14-12-19(2)15-22(25)17-27)23-16-20(3)11-13-24(23)28-18-21-9-7-6-8-10-21/h6-16,27,29H,5,17-18H2,1-4H3 |
| InChIKey | UVJODVOGSQGMHI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|