C27H34OP2 — CID 71039959
dimethyl-[[3-methyl-2-[2-(2-phenylmethoxyphenyl)butan-2-ylphosphanyl]phenyl]methyl]phosphane (PubChem CID 71039959) has the molecular formula C27H34OP2 and a molecular weight of 436.52 g/mol. Its IUPAC name is dimethyl-[[3-methyl-2-[2-(2-phenylmethoxyphenyl)butan-2-ylphosphanyl]phenyl]methyl]phosphane.
| Compound Name | dimethyl-[[3-methyl-2-[2-(2-phenylmethoxyphenyl)butan-2-ylphosphanyl]phenyl]methyl]phosphane |
|---|---|
| PubChem CID | 71039959 |
| Molecular Formula | C27H34OP2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | dimethyl-[[3-methyl-2-[2-(2-phenylmethoxyphenyl)butan-2-ylphosphanyl]phenyl]methyl]phosphane |
| SMILES | CCC(C)(Pc1c(C)cccc1CP(C)C)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H34OP2/c1-6-27(3,29-26-21(2)13-12-16-23(26)20-30(4)5)24-17-10-11-18-25(24)28-19-22-14-8-7-9-15-22/h7-18,29H,6,19-20H2,1-5H3 |
| InChIKey | BFHKKKHPPAFQPM-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|