C24H22F5OP — CID 88969075
(2,3,4,5,6-pentafluorophenyl)-[3-(2-phenylmethoxyphenyl)pentan-3-yl]phosphane (PubChem CID 88969075) has the molecular formula C24H22F5OP and a molecular weight of 452.40 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)-[3-(2-phenylmethoxyphenyl)pentan-3-yl]phosphane.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)-[3-(2-phenylmethoxyphenyl)pentan-3-yl]phosphane |
|---|---|
| PubChem CID | 88969075 |
| Molecular Formula | C24H22F5OP |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)-[3-(2-phenylmethoxyphenyl)pentan-3-yl]phosphane |
| SMILES | CCC(CC)(Pc1c(F)c(F)c(F)c(F)c1F)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H22F5OP/c1-3-24(4-2,31-23-21(28)19(26)18(25)20(27)22(23)29)16-12-8-9-13-17(16)30-14-15-10-6-5-7-11-15/h5-13,31H,3-4,14H2,1-2H3 |
| InChIKey | GUNNHZHQSBDQLL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|