C28H36NOP — CID 71040177
2-[2-[2-[(tert-butylamino)methyl]-6-methylphenyl]phosphanylbutan-2-yl]-6-phenylphenol (PubChem CID 71040177) has the molecular formula C28H36NOP and a molecular weight of 433.58 g/mol. Its IUPAC name is 2-[2-[2-[(tert-butylamino)methyl]-6-methylphenyl]phosphanylbutan-2-yl]-6-phenylphenol.
| Compound Name | 2-[2-[2-[(tert-butylamino)methyl]-6-methylphenyl]phosphanylbutan-2-yl]-6-phenylphenol |
|---|---|
| PubChem CID | 71040177 |
| Molecular Formula | C28H36NOP |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 2-[2-[2-[(tert-butylamino)methyl]-6-methylphenyl]phosphanylbutan-2-yl]-6-phenylphenol |
| SMILES | CCC(C)(Pc1c(C)cccc1CNC(C)(C)C)c1cccc(-c2ccccc2)c1O |
| InChI | InChI=1S/C28H36NOP/c1-7-28(6,24-18-12-17-23(25(24)30)21-14-9-8-10-15-21)31-26-20(2)13-11-16-22(26)19-29-27(3,4)5/h8-18,29-31H,7,19H2,1-6H3 |
| InChIKey | ZYMJZSKSQLIZSX-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|