C32H44NO2P — CID 89214378
N-[[2-[3-[3-benzyl-2-(methoxymethoxy)phenyl]pentan-3-ylphosphanyl]-3-methylphenyl]methyl]-2-methylpropan-2-amine (PubChem CID 89214378) has the molecular formula C32H44NO2P and a molecular weight of 505.68 g/mol. Its IUPAC name is N-[[2-[3-[3-benzyl-2-(methoxymethoxy)phenyl]pentan-3-ylphosphanyl]-3-methylphenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-[3-[3-benzyl-2-(methoxymethoxy)phenyl]pentan-3-ylphosphanyl]-3-methylphenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 89214378 |
| Molecular Formula | C32H44NO2P |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | N-[[2-[3-[3-benzyl-2-(methoxymethoxy)phenyl]pentan-3-ylphosphanyl]-3-methylphenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CCC(CC)(Pc1c(C)cccc1CNC(C)(C)C)c1cccc(Cc2ccccc2)c1OCOC |
| InChI | InChI=1S/C32H44NO2P/c1-8-32(9-2,36-30-24(3)15-13-19-27(30)22-33-31(4,5)6)28-20-14-18-26(29(28)35-23-34-7)21-25-16-11-10-12-17-25/h10-20,33,36H,8-9,21-23H2,1-7H3 |
| InChIKey | OXTGCLOMRYUHDL-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|