C37H44NOP — CID 71039995
1-[2-[3-(5-tert-butyl-3-methyl-2-phenylmethoxyphenyl)pentan-3-ylphosphanyl]-3-methylphenyl]-N-phenylmethanimine (PubChem CID 71039995) has the molecular formula C37H44NOP and a molecular weight of 549.74 g/mol. Its IUPAC name is 1-[2-[3-(5-tert-butyl-3-methyl-2-phenylmethoxyphenyl)pentan-3-ylphosphanyl]-3-methylphenyl]-N-phenylmethanimine.
| Compound Name | 1-[2-[3-(5-tert-butyl-3-methyl-2-phenylmethoxyphenyl)pentan-3-ylphosphanyl]-3-methylphenyl]-N-phenylmethanimine |
|---|---|
| PubChem CID | 71039995 |
| Molecular Formula | C37H44NOP |
| Molecular Weight | 549.74 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | 1-[2-[3-(5-tert-butyl-3-methyl-2-phenylmethoxyphenyl)pentan-3-ylphosphanyl]-3-methylphenyl]-N-phenylmethanimine |
| SMILES | CCC(CC)(Pc1c(C)cccc1/C=N\c1ccccc1)c1cc(C(C)(C)C)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C37H44NOP/c1-8-37(9-2,40-35-27(3)17-16-20-30(35)25-38-32-21-14-11-15-22-32)33-24-31(36(5,6)7)23-28(4)34(33)39-26-29-18-12-10-13-19-29/h10-25,40H,8-9,26H2,1-7H3/b38-25- |
| InChIKey | OKRATNGCJAPSCU-NHXQZRDHSA-N |
| XLogP | 9.95 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.74 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|