C35H40NOP — CID 88969336
1-[2-[3-(3,5-dimethyl-2-phenylmethoxyphenyl)pentan-3-ylphosphanyl]-3-methylphenyl]-N-phenylethanimine (PubChem CID 88969336) has the molecular formula C35H40NOP and a molecular weight of 521.69 g/mol. Its IUPAC name is 1-[2-[3-(3,5-dimethyl-2-phenylmethoxyphenyl)pentan-3-ylphosphanyl]-3-methylphenyl]-N-phenylethanimine.
| Compound Name | 1-[2-[3-(3,5-dimethyl-2-phenylmethoxyphenyl)pentan-3-ylphosphanyl]-3-methylphenyl]-N-phenylethanimine |
|---|---|
| PubChem CID | 88969336 |
| Molecular Formula | C35H40NOP |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | 1-[2-[3-(3,5-dimethyl-2-phenylmethoxyphenyl)pentan-3-ylphosphanyl]-3-methylphenyl]-N-phenylethanimine |
| SMILES | CCC(CC)(Pc1c(C)cccc1/C(C)=N\c1ccccc1)c1cc(C)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C35H40NOP/c1-7-35(8-2,32-23-25(3)22-27(5)33(32)37-24-29-17-11-9-12-18-29)38-34-26(4)16-15-21-31(34)28(6)36-30-19-13-10-14-20-30/h9-23,38H,7-8,24H2,1-6H3/b36-28- |
| InChIKey | FEFFFUUXKQCWJM-DKJXEYTPSA-N |
| XLogP | 9.35 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|