C34H38NOP — CID 88968917
1-[2-[2-(3,5-dimethyl-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]-3-methylphenyl]-N-methyl-1-phenylmethanimine (PubChem CID 88968917) has the molecular formula C34H38NOP and a molecular weight of 507.66 g/mol. Its IUPAC name is 1-[2-[2-(3,5-dimethyl-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]-3-methylphenyl]-N-methyl-1-phenylmethanimine.
| Compound Name | 1-[2-[2-(3,5-dimethyl-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]-3-methylphenyl]-N-methyl-1-phenylmethanimine |
|---|---|
| PubChem CID | 88968917 |
| Molecular Formula | C34H38NOP |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 1-[2-[2-(3,5-dimethyl-2-phenylmethoxyphenyl)butan-2-ylphosphanyl]-3-methylphenyl]-N-methyl-1-phenylmethanimine |
| SMILES | CCC(C)(Pc1c(C)cccc1/C(=N/C)c1ccccc1)c1cc(C)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C34H38NOP/c1-7-34(5,30-22-24(2)21-26(4)32(30)36-23-27-16-10-8-11-17-27)37-33-25(3)15-14-20-29(33)31(35-6)28-18-12-9-13-19-28/h8-22,37H,7,23H2,1-6H3/b35-31+ |
| InChIKey | UUAMPIWAIKARHZ-JSLDZMDGSA-N |
| XLogP | 8.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|