C32H36NO2P — CID 70807505
2-methoxy-6-[3-[2-methyl-6-[(N-phenylanilino)methyl]phenyl]phosphanylpentan-3-yl]phenol (PubChem CID 70807505) has the molecular formula C32H36NO2P and a molecular weight of 497.62 g/mol. Its IUPAC name is 2-methoxy-6-[3-[2-methyl-6-[(N-phenylanilino)methyl]phenyl]phosphanylpentan-3-yl]phenol.
| Compound Name | 2-methoxy-6-[3-[2-methyl-6-[(N-phenylanilino)methyl]phenyl]phosphanylpentan-3-yl]phenol |
|---|---|
| PubChem CID | 70807505 |
| Molecular Formula | C32H36NO2P |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 2-methoxy-6-[3-[2-methyl-6-[(N-phenylanilino)methyl]phenyl]phosphanylpentan-3-yl]phenol |
| SMILES | CCC(CC)(Pc1c(C)cccc1CN(c1ccccc1)c1ccccc1)c1cccc(OC)c1O |
| InChI | InChI=1S/C32H36NO2P/c1-5-32(6-2,28-21-14-22-29(35-4)30(28)34)36-31-24(3)15-13-16-25(31)23-33(26-17-9-7-10-18-26)27-19-11-8-12-20-27/h7-22,34,36H,5-6,23H2,1-4H3 |
| InChIKey | QGEWUZZFCMKGDX-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|