C20H24F3OP — CID 71191689
2-[3-[2-methyl-6-(trifluoromethyl)phenyl]phosphanylhexan-3-yl]phenol (PubChem CID 71191689) has the molecular formula C20H24F3OP and a molecular weight of 368.38 g/mol. Its IUPAC name is 2-[3-[2-methyl-6-(trifluoromethyl)phenyl]phosphanylhexan-3-yl]phenol.
| Compound Name | 2-[3-[2-methyl-6-(trifluoromethyl)phenyl]phosphanylhexan-3-yl]phenol |
|---|---|
| PubChem CID | 71191689 |
| Molecular Formula | C20H24F3OP |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[3-[2-methyl-6-(trifluoromethyl)phenyl]phosphanylhexan-3-yl]phenol |
| SMILES | CCCC(CC)(Pc1c(C)cccc1C(F)(F)F)c1ccccc1O |
| InChI | InChI=1S/C20H24F3OP/c1-4-13-19(5-2,15-10-6-7-12-17(15)24)25-18-14(3)9-8-11-16(18)20(21,22)23/h6-12,24-25H,4-5,13H2,1-3H3 |
| InChIKey | ATTICNALZLFLCO-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|